C15H15ClN2O4S — CID 1372382
2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]acetamide (PubChem CID 1372382) has the molecular formula C15H15ClN2O4S and a molecular weight of 354.82 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]acetamide |
|---|---|
| PubChem CID | 1372382 |
| Molecular Formula | C15H15ClN2O4S |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-chloro-4-methoxyanilino]acetamide |
| SMILES | COc1ccc(N(CC(N)=O)S(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C15H15ClN2O4S/c1-22-14-8-7-11(9-13(14)16)18(10-15(17)19)23(20,21)12-5-3-2-4-6-12/h2-9H,10H2,1H3,(H2,17,19) |
| InChIKey | FUVIRRJQLMAORE-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |