propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate

C17H18FNO4S — CID 50890112

IUPACpropan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate
SMILESCC(C)OC(=O)CN(c1ccccc1F)S(=O)(=O)c1ccccc1
InChIInChI=1S/C17H18FNO4S/c1-13(2)23-17(20)12-19(16-11-7-6-10-15(16)18)24(21,22)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3
InChIKeyCTRZLOZCOMXNCB-UHFFFAOYSA-N
MW351.40 g/mol
LogP2.97
Rot. Bonds6

About propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate

propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate (PubChem CID 50890112) has the molecular formula C17H18FNO4S and a molecular weight of 351.40 g/mol. Its IUPAC name is propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate.

Molecular Properties

Compound Namepropan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate
PubChem CID50890112
Molecular FormulaC17H18FNO4S
Molecular Weight351.40 g/mol
Exact Mass351.09
IUPAC Namepropan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate
SMILESCC(C)OC(=O)CN(c1ccccc1F)S(=O)(=O)c1ccccc1
InChIInChI=1S/C17H18FNO4S/c1-13(2)23-17(20)12-19(16-11-7-6-10-15(16)18)24(21,22)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3
InChIKeyCTRZLOZCOMXNCB-UHFFFAOYSA-N
XLogP2.97
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500351.40
LogP ≤ 52.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate?
The IUPAC name of propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate (CID 50890112) is propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate.
What is the SMILES notation for propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate?
The canonical SMILES for propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate is CC(C)OC(=O)CN(c1ccccc1F)S(=O)(=O)c1ccccc1.
What is the InChIKey of propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate?
The InChIKey is CTRZLOZCOMXNCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FNO4S/c1-13(2)23-17(20)12-19(16-11-7-6-10-15(16)18)24(21,22)14-8-4-3-5-9-14/h3-11,13H,12H2,1-2H3.
What are the key properties of propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate?
propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate has a molecular weight of 351.40 g/mol, XLogP of 2.97, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 2-[N-(benzenesulfonyl)-2-fluoroanilino]acetate is sourced from PubChem (CID 50890112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).