C11H15FN2O5S2 — CID 103101779
2-[ethyl-(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]acetamide (PubChem CID 103101779) has the molecular formula C11H15FN2O5S2 and a molecular weight of 338.38 g/mol. Its IUPAC name is 2-[ethyl-(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]acetamide.
| Compound Name | 2-[ethyl-(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 103101779 |
| Molecular Formula | C11H15FN2O5S2 |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | 2-[ethyl-(2-fluoro-5-methylsulfonylphenyl)sulfonylamino]acetamide |
| SMILES | CCN(CC(N)=O)S(=O)(=O)c1cc(S(C)(=O)=O)ccc1F |
| InChI | InChI=1S/C11H15FN2O5S2/c1-3-14(7-11(13)15)21(18,19)10-6-8(20(2,16)17)4-5-9(10)12/h4-6H,3,7H2,1-2H3,(H2,13,15) |
| InChIKey | UZQXAUIQFZJPGK-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 114.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |