C24H29FN4O4S — CID 16917575
4-(dibutylsulfamoyl)-N-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 16917575) has the molecular formula C24H29FN4O4S and a molecular weight of 488.59 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16917575 |
| Molecular Formula | C24H29FN4O4S |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-[5-[(4-fluorophenyl)methyl]-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)Nc2nnc(Cc3ccc(F)cc3)o2)cc1 |
| InChI | InChI=1S/C24H29FN4O4S/c1-3-5-15-29(16-6-4-2)34(31,32)21-13-9-19(10-14-21)23(30)26-24-28-27-22(33-24)17-18-7-11-20(25)12-8-18/h7-14H,3-6,15-17H2,1-2H3,(H,26,28,30) |
| InChIKey | YZKXEPSQUFUZQI-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |