C24H30N4O4S — CID 16917366
N-(5-benzyl-1,3,4-oxadiazol-2-yl)-4-[bis(2-methylpropyl)sulfamoyl]benzamide (PubChem CID 16917366) has the molecular formula C24H30N4O4S and a molecular weight of 470.60 g/mol. Its IUPAC name is N-(5-benzyl-1,3,4-oxadiazol-2-yl)-4-[bis(2-methylpropyl)sulfamoyl]benzamide.
| Compound Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-4-[bis(2-methylpropyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 16917366 |
| Molecular Formula | C24H30N4O4S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | N-(5-benzyl-1,3,4-oxadiazol-2-yl)-4-[bis(2-methylpropyl)sulfamoyl]benzamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccc(C(=O)Nc2nnc(Cc3ccccc3)o2)cc1 |
| InChI | InChI=1S/C24H30N4O4S/c1-17(2)15-28(16-18(3)4)33(30,31)21-12-10-20(11-13-21)23(29)25-24-27-26-22(32-24)14-19-8-6-5-7-9-19/h5-13,17-18H,14-16H2,1-4H3,(H,25,27,29) |
| InChIKey | ZLSZOAGNEGTDQB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |