C25H32N4O6S — CID 4046837
4-(dibutylsulfamoyl)-N-[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide (PubChem CID 4046837) has the molecular formula C25H32N4O6S and a molecular weight of 516.62 g/mol. Its IUPAC name is 4-(dibutylsulfamoyl)-N-[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide.
| Compound Name | 4-(dibutylsulfamoyl)-N-[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4046837 |
| Molecular Formula | C25H32N4O6S |
| Molecular Weight | 516.62 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 4-(dibutylsulfamoyl)-N-[5-(2,6-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]benzamide |
| SMILES | CCCCN(CCCC)S(=O)(=O)c1ccc(C(=O)Nc2nnc(-c3c(OC)cccc3OC)o2)cc1 |
| InChI | InChI=1S/C25H32N4O6S/c1-5-7-16-29(17-8-6-2)36(31,32)19-14-12-18(13-15-19)23(30)26-25-28-27-24(35-25)22-20(33-3)10-9-11-21(22)34-4/h9-15H,5-8,16-17H2,1-4H3,(H,26,28,30) |
| InChIKey | WDZKRQBVDFLCLD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.62 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |