C33H40BrN2O4S+ — CID 89247250
bromomethyl-[4-[(3,4-dihydroxyphenyl)sulfonyl-(naphthalen-2-ylmethyl)amino]butyl]-[(3,5-dimethylphenyl)methyl]-ethylazanium (PubChem CID 89247250) has the molecular formula C33H40BrN2O4S+ and a molecular weight of 640.66 g/mol. Its IUPAC name is bromomethyl-[4-[(3,4-dihydroxyphenyl)sulfonyl-(naphthalen-2-ylmethyl)amino]butyl]-[(3,5-dimethylphenyl)methyl]-ethylazanium.
| Compound Name | bromomethyl-[4-[(3,4-dihydroxyphenyl)sulfonyl-(naphthalen-2-ylmethyl)amino]butyl]-[(3,5-dimethylphenyl)methyl]-ethylazanium |
|---|---|
| PubChem CID | 89247250 |
| Molecular Formula | C33H40BrN2O4S+ |
| Molecular Weight | 640.66 g/mol |
| Exact Mass | 639.19 |
| IUPAC Name | bromomethyl-[4-[(3,4-dihydroxyphenyl)sulfonyl-(naphthalen-2-ylmethyl)amino]butyl]-[(3,5-dimethylphenyl)methyl]-ethylazanium |
| SMILES | CC[N+](CBr)(CCCCN(Cc1ccc2ccccc2c1)S(=O)(=O)c1ccc(O)c(O)c1)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C33H39BrN2O4S/c1-4-36(24-34,23-28-18-25(2)17-26(3)19-28)16-8-7-15-35(41(39,40)31-13-14-32(37)33(38)21-31)22-27-11-12-29-9-5-6-10-30(29)20-27/h5-6,9-14,17-21H,4,7-8,15-16,22-24H2,1-3H3,(H-,37,38)/p+1 |
| InChIKey | BPIWDXZKJUDHIG-UHFFFAOYSA-O |
| XLogP | 7.23 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.66 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|