C22H31Cl2N2O2S+ — CID 59780870
4-[(3,4-dichlorophenyl)sulfonyl-[(3,5-dimethylphenyl)methyl]amino]butyl-trimethylazanium (PubChem CID 59780870) has the molecular formula C22H31Cl2N2O2S+ and a molecular weight of 458.48 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)sulfonyl-[(3,5-dimethylphenyl)methyl]amino]butyl-trimethylazanium.
| Compound Name | 4-[(3,4-dichlorophenyl)sulfonyl-[(3,5-dimethylphenyl)methyl]amino]butyl-trimethylazanium |
|---|---|
| PubChem CID | 59780870 |
| Molecular Formula | C22H31Cl2N2O2S+ |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)sulfonyl-[(3,5-dimethylphenyl)methyl]amino]butyl-trimethylazanium |
| SMILES | Cc1cc(C)cc(CN(CCCC[N+](C)(C)C)S(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C22H31Cl2N2O2S/c1-17-12-18(2)14-19(13-17)16-25(10-6-7-11-26(3,4)5)29(27,28)20-8-9-21(23)22(24)15-20/h8-9,12-15H,6-7,10-11,16H2,1-5H3/q+1 |
| InChIKey | IEAFDZUKPWYPBL-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|