C36H43BrN2O2S2 — CID 159925451
4-[1-benzothiophen-5-ylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide (PubChem CID 159925451) has the molecular formula C36H43BrN2O2S2 and a molecular weight of 679.79 g/mol. Its IUPAC name is 4-[1-benzothiophen-5-ylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide.
| Compound Name | 4-[1-benzothiophen-5-ylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
|---|---|
| PubChem CID | 159925451 |
| Molecular Formula | C36H43BrN2O2S2 |
| Molecular Weight | 679.79 g/mol |
| Exact Mass | 678.19 |
| IUPAC Name | 4-[1-benzothiophen-5-ylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
| SMILES | CC[N+](CC)(CCCCN(Cc1ccc2sccc2c1)S(=O)(=O)c1ccc2ccccc2c1)Cc1cc(C)cc(C)c1.[Br-] |
| InChI | InChI=1S/C36H43N2O2S2.BrH/c1-5-38(6-2,27-31-22-28(3)21-29(4)23-31)19-10-9-18-37(26-30-13-16-36-34(24-30)17-20-41-36)42(39,40)35-15-14-32-11-7-8-12-33(32)25-35;/h7-8,11-17,20-25H,5-6,9-10,18-19,26-27H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FJBYQBOSIOKBHD-UHFFFAOYSA-M |
| XLogP | 5.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.79 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|