C37H43Cl2N2O+ — CID 59780965
4-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium (PubChem CID 59780965) has the molecular formula C37H43Cl2N2O+ and a molecular weight of 602.67 g/mol. Its IUPAC name is 4-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium.
| Compound Name | 4-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
|---|---|
| PubChem CID | 59780965 |
| Molecular Formula | C37H43Cl2N2O+ |
| Molecular Weight | 602.67 g/mol |
| Exact Mass | 601.27 |
| IUPAC Name | 4-[[(E)-3-(2,5-dichlorophenyl)prop-2-enoyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
| SMILES | CC[N+](CC)(CCCCN(Cc1ccc2ccccc2c1)C(=O)/C=C/c1cc(Cl)ccc1Cl)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C37H43Cl2N2O/c1-5-41(6-2,27-31-22-28(3)21-29(4)23-31)20-10-9-19-40(26-30-13-14-32-11-7-8-12-33(32)24-30)37(42)18-15-34-25-35(38)16-17-36(34)39/h7-8,11-18,21-25H,5-6,9-10,19-20,26-27H2,1-4H3/q+1/b18-15+ |
| InChIKey | HEBXDACGUGQBAW-OBGWFSINSA-N |
| XLogP | 9.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.67 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|