C28H32Cl2N2O — CID 59780976
(E)-3-(2,5-dichlorophenyl)-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)prop-2-enamide (PubChem CID 59780976) has the molecular formula C28H32Cl2N2O and a molecular weight of 483.48 g/mol. Its IUPAC name is (E)-3-(2,5-dichlorophenyl)-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(2,5-dichlorophenyl)-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 59780976 |
| Molecular Formula | C28H32Cl2N2O |
| Molecular Weight | 483.48 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (E)-3-(2,5-dichlorophenyl)-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)prop-2-enamide |
| SMILES | CCN(CC)CCCCN(Cc1ccc2ccccc2c1)C(=O)/C=C/c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C28H32Cl2N2O/c1-3-31(4-2)17-7-8-18-32(21-22-11-12-23-9-5-6-10-24(23)19-22)28(33)16-13-25-20-26(29)14-15-27(25)30/h5-6,9-16,19-20H,3-4,7-8,17-18,21H2,1-2H3/b16-13+ |
| InChIKey | FPMUTACIAIUDTI-DTQAZKPQSA-N |
| XLogP | 7.31 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.48 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|