C29H31ClF2N2O2S — CID 59780742
3-chloro-N-[4-(diethylamino)butyl]-4-(difluoromethoxy)-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 59780742) has the molecular formula C29H31ClF2N2O2S and a molecular weight of 545.10 g/mol. Its IUPAC name is 3-chloro-N-[4-(diethylamino)butyl]-4-(difluoromethoxy)-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-(diethylamino)butyl]-4-(difluoromethoxy)-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 59780742 |
| Molecular Formula | C29H31ClF2N2O2S |
| Molecular Weight | 545.10 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | 3-chloro-N-[4-(diethylamino)butyl]-4-(difluoromethoxy)-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)CCCCN(Cc1ccc2ccccc2c1)C(=O)c1sc2cccc(OC(F)F)c2c1Cl |
| InChI | InChI=1S/C29H31ClF2N2O2S/c1-3-33(4-2)16-7-8-17-34(19-20-14-15-21-10-5-6-11-22(21)18-20)28(35)27-26(30)25-23(36-29(31)32)12-9-13-24(25)37-27/h5-6,9-15,18,29H,3-4,7-8,16-17,19H2,1-2H3 |
| InChIKey | TUPMRJVCMLJMMC-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.10 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|