C28H29Cl3N2OS — CID 59780980
3,4,6-trichloro-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 59780980) has the molecular formula C28H29Cl3N2OS and a molecular weight of 547.98 g/mol. Its IUPAC name is 3,4,6-trichloro-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3,4,6-trichloro-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 59780980 |
| Molecular Formula | C28H29Cl3N2OS |
| Molecular Weight | 547.98 g/mol |
| Exact Mass | 546.11 |
| IUPAC Name | 3,4,6-trichloro-N-[4-(diethylamino)butyl]-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)CCCCN(Cc1ccc2ccccc2c1)C(=O)c1sc2cc(Cl)cc(Cl)c2c1Cl |
| InChI | InChI=1S/C28H29Cl3N2OS/c1-3-32(4-2)13-7-8-14-33(18-19-11-12-20-9-5-6-10-21(20)15-19)28(34)27-26(31)25-23(30)16-22(29)17-24(25)35-27/h5-6,9-12,15-17H,3-4,7-8,13-14,18H2,1-2H3 |
| InChIKey | MXRQZHUXQUNAMP-UHFFFAOYSA-N |
| XLogP | 8.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.98 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|