C38H40BrClF4N2OS — CID 158204011
4-[[3-chloro-7-fluoro-4-(trifluoromethyl)-1-benzothiophene-2-carbonyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide (PubChem CID 158204011) has the molecular formula C38H40BrClF4N2OS and a molecular weight of 764.17 g/mol. Its IUPAC name is 4-[[3-chloro-7-fluoro-4-(trifluoromethyl)-1-benzothiophene-2-carbonyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide.
| Compound Name | 4-[[3-chloro-7-fluoro-4-(trifluoromethyl)-1-benzothiophene-2-carbonyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
|---|---|
| PubChem CID | 158204011 |
| Molecular Formula | C38H40BrClF4N2OS |
| Molecular Weight | 764.17 g/mol |
| Exact Mass | 762.17 |
| IUPAC Name | 4-[[3-chloro-7-fluoro-4-(trifluoromethyl)-1-benzothiophene-2-carbonyl]-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
| SMILES | CC[N+](CC)(CCCCN(Cc1ccc2ccccc2c1)C(=O)c1sc2c(F)ccc(C(F)(F)F)c2c1Cl)Cc1cc(C)cc(C)c1.[Br-] |
| InChI | InChI=1S/C38H40ClF4N2OS.BrH/c1-5-45(6-2,24-28-20-25(3)19-26(4)21-28)18-10-9-17-44(23-27-13-14-29-11-7-8-12-30(29)22-27)37(46)36-34(39)33-31(38(41,42)43)15-16-32(40)35(33)47-36;/h7-8,11-16,19-22H,5-6,9-10,17-18,23-24H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | OQGWTLMLNVOHRA-UHFFFAOYSA-M |
| XLogP | 7.97 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.17 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|