C26H34ClN2OS+ — CID 59780812
2-[(3-chloro-1-benzothiophene-2-carbonyl)-ethylamino]ethyl-[(3,5-dimethylphenyl)methyl]-diethylazanium (PubChem CID 59780812) has the molecular formula C26H34ClN2OS+ and a molecular weight of 458.09 g/mol. Its IUPAC name is 2-[(3-chloro-1-benzothiophene-2-carbonyl)-ethylamino]ethyl-[(3,5-dimethylphenyl)methyl]-diethylazanium.
| Compound Name | 2-[(3-chloro-1-benzothiophene-2-carbonyl)-ethylamino]ethyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
|---|---|
| PubChem CID | 59780812 |
| Molecular Formula | C26H34ClN2OS+ |
| Molecular Weight | 458.09 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | 2-[(3-chloro-1-benzothiophene-2-carbonyl)-ethylamino]ethyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
| SMILES | CCN(CC[N+](CC)(CC)Cc1cc(C)cc(C)c1)C(=O)c1sc2ccccc2c1Cl |
| InChI | InChI=1S/C26H34ClN2OS/c1-6-28(26(30)25-24(27)22-11-9-10-12-23(22)31-25)13-14-29(7-2,8-3)18-21-16-19(4)15-20(5)17-21/h9-12,15-17H,6-8,13-14,18H2,1-5H3/q+1 |
| InChIKey | PAGSKVATAKMFNY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.09 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|