C40H44BrClN2O3 — CID 158505330
4-[anthracene-9-carbonyl-[(6-chloro-1,3-benzodioxol-5-yl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide (PubChem CID 158505330) has the molecular formula C40H44BrClN2O3 and a molecular weight of 716.16 g/mol. Its IUPAC name is 4-[anthracene-9-carbonyl-[(6-chloro-1,3-benzodioxol-5-yl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide.
| Compound Name | 4-[anthracene-9-carbonyl-[(6-chloro-1,3-benzodioxol-5-yl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
|---|---|
| PubChem CID | 158505330 |
| Molecular Formula | C40H44BrClN2O3 |
| Molecular Weight | 716.16 g/mol |
| Exact Mass | 714.22 |
| IUPAC Name | 4-[anthracene-9-carbonyl-[(6-chloro-1,3-benzodioxol-5-yl)methyl]amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
| SMILES | CC[N+](CC)(CCCCN(Cc1cc2c(cc1Cl)OCO2)C(=O)c1c2ccccc2cc2ccccc12)Cc1cc(C)cc(C)c1.[Br-] |
| InChI | InChI=1S/C40H44ClN2O3.BrH/c1-5-43(6-2,26-30-20-28(3)19-29(4)21-30)18-12-11-17-42(25-33-23-37-38(24-36(33)41)46-27-45-37)40(44)39-34-15-9-7-13-31(34)22-32-14-8-10-16-35(32)39;/h7-10,13-16,19-24H,5-6,11-12,17-18,25-27H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | IRPDVDBOFZZABS-UHFFFAOYSA-M |
| XLogP | 6.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.16 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|