C42H47N2OS+ — CID 145462542
(3,5-dimethylphenyl)methyl-diethyl-[4-[(1-methylbenzo[e][1]benzothiole-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl]azanium (PubChem CID 145462542) has the molecular formula C42H47N2OS+ and a molecular weight of 627.92 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl-diethyl-[4-[(1-methylbenzo[e][1]benzothiole-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl]azanium.
| Compound Name | (3,5-dimethylphenyl)methyl-diethyl-[4-[(1-methylbenzo[e][1]benzothiole-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl]azanium |
|---|---|
| PubChem CID | 145462542 |
| Molecular Formula | C42H47N2OS+ |
| Molecular Weight | 627.92 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | (3,5-dimethylphenyl)methyl-diethyl-[4-[(1-methylbenzo[e][1]benzothiole-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl]azanium |
| SMILES | CC[N+](CC)(CCCCN(Cc1ccc2ccccc2c1)C(=O)c1sc2ccc3ccccc3c2c1C)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C42H47N2OS/c1-6-44(7-2,29-34-25-30(3)24-31(4)26-34)23-13-12-22-43(28-33-18-19-35-14-8-9-16-37(35)27-33)42(45)41-32(5)40-38-17-11-10-15-36(38)20-21-39(40)46-41/h8-11,14-21,24-27H,6-7,12-13,22-23,28-29H2,1-5H3/q+1 |
| InChIKey | POCOZFZNAGXFLK-UHFFFAOYSA-N |
| XLogP | 10.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.92 |
| LogP ≤ 5 | 10.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|