C37H42ClN2O2+ — CID 59781069
4-[(5-chloro-1-benzofuran-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium (PubChem CID 59781069) has the molecular formula C37H42ClN2O2+ and a molecular weight of 582.21 g/mol. Its IUPAC name is 4-[(5-chloro-1-benzofuran-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium.
| Compound Name | 4-[(5-chloro-1-benzofuran-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
|---|---|
| PubChem CID | 59781069 |
| Molecular Formula | C37H42ClN2O2+ |
| Molecular Weight | 582.21 g/mol |
| Exact Mass | 581.29 |
| IUPAC Name | 4-[(5-chloro-1-benzofuran-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
| SMILES | CC[N+](CC)(CCCCN(Cc1ccc2ccccc2c1)C(=O)c1cc2cc(Cl)ccc2o1)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C37H42ClN2O2/c1-5-40(6-2,26-30-20-27(3)19-28(4)21-30)18-10-9-17-39(25-29-13-14-31-11-7-8-12-32(31)22-29)37(41)36-24-33-23-34(38)15-16-35(33)42-36/h7-8,11-16,19-24H,5-6,9-10,17-18,25-26H2,1-4H3/q+1 |
| InChIKey | XASUQMXVXKLGKT-UHFFFAOYSA-N |
| XLogP | 9.34 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.21 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|