C37H41Cl2N2OS+ — CID 59781090
4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium (PubChem CID 59781090) has the molecular formula C37H41Cl2N2OS+ and a molecular weight of 632.72 g/mol. Its IUPAC name is 4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium.
| Compound Name | 4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
|---|---|
| PubChem CID | 59781090 |
| Molecular Formula | C37H41Cl2N2OS+ |
| Molecular Weight | 632.72 g/mol |
| Exact Mass | 631.23 |
| IUPAC Name | 4-[(3,6-dichloro-1-benzothiophene-2-carbonyl)-(naphthalen-2-ylmethyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium |
| SMILES | CC[N+](CC)(CCCCN(Cc1ccc2ccccc2c1)C(=O)c1sc2cc(Cl)ccc2c1Cl)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C37H41Cl2N2OS/c1-5-41(6-2,25-29-20-26(3)19-27(4)21-29)18-10-9-17-40(24-28-13-14-30-11-7-8-12-31(30)22-28)37(42)36-35(39)33-16-15-32(38)23-34(33)43-36/h7-8,11-16,19-23H,5-6,9-10,17-18,24-25H2,1-4H3/q+1 |
| InChIKey | SEBPLKKUXPAYKP-UHFFFAOYSA-N |
| XLogP | 10.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.72 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|