C30H35ClN2O3S — CID 59781076
3-chloro-N-[4-(diethylamino)butyl]-5,6-dimethoxy-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 59781076) has the molecular formula C30H35ClN2O3S and a molecular weight of 539.14 g/mol. Its IUPAC name is 3-chloro-N-[4-(diethylamino)butyl]-5,6-dimethoxy-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-N-[4-(diethylamino)butyl]-5,6-dimethoxy-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 59781076 |
| Molecular Formula | C30H35ClN2O3S |
| Molecular Weight | 539.14 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 3-chloro-N-[4-(diethylamino)butyl]-5,6-dimethoxy-N-(naphthalen-2-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | CCN(CC)CCCCN(Cc1ccc2ccccc2c1)C(=O)c1sc2cc(OC)c(OC)cc2c1Cl |
| InChI | InChI=1S/C30H35ClN2O3S/c1-5-32(6-2)15-9-10-16-33(20-21-13-14-22-11-7-8-12-23(22)17-21)30(34)29-28(31)24-18-25(35-3)26(36-4)19-27(24)37-29/h7-8,11-14,17-19H,5-6,9-10,15-16,20H2,1-4H3 |
| InChIKey | VERZMJMUOOSAJW-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.14 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|