C31H43BrN2O2S — CID 159514290
4-[cyclopropylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide (PubChem CID 159514290) has the molecular formula C31H43BrN2O2S and a molecular weight of 587.67 g/mol. Its IUPAC name is 4-[cyclopropylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide.
| Compound Name | 4-[cyclopropylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
|---|---|
| PubChem CID | 159514290 |
| Molecular Formula | C31H43BrN2O2S |
| Molecular Weight | 587.67 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 4-[cyclopropylmethyl(naphthalen-2-ylsulfonyl)amino]butyl-[(3,5-dimethylphenyl)methyl]-diethylazanium bromide |
| SMILES | CC[N+](CC)(CCCCN(CC1CC1)S(=O)(=O)c1ccc2ccccc2c1)Cc1cc(C)cc(C)c1.[Br-] |
| InChI | InChI=1S/C31H43N2O2S.BrH/c1-5-33(6-2,24-28-20-25(3)19-26(4)21-28)18-10-9-17-32(23-27-13-14-27)36(34,35)31-16-15-29-11-7-8-12-30(29)22-31;/h7-8,11-12,15-16,19-22,27H,5-6,9-10,13-14,17-18,23-24H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | GUGIWBUHHZYYQM-UHFFFAOYSA-M |
| XLogP | 3.70 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.67 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|