C22H30N2O4S — CID 69025832
[4-[[naphthalen-2-ylsulfonyl(propyl)amino]methyl]cyclohexyl]methylcarbamic acid (PubChem CID 69025832) has the molecular formula C22H30N2O4S and a molecular weight of 418.56 g/mol. Its IUPAC name is [4-[[naphthalen-2-ylsulfonyl(propyl)amino]methyl]cyclohexyl]methylcarbamic acid.
| Compound Name | [4-[[naphthalen-2-ylsulfonyl(propyl)amino]methyl]cyclohexyl]methylcarbamic acid |
|---|---|
| PubChem CID | 69025832 |
| Molecular Formula | C22H30N2O4S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | [4-[[naphthalen-2-ylsulfonyl(propyl)amino]methyl]cyclohexyl]methylcarbamic acid |
| SMILES | CCCN(CC1CCC(CNC(=O)O)CC1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H30N2O4S/c1-2-13-24(16-18-9-7-17(8-10-18)15-23-22(25)26)29(27,28)21-12-11-19-5-3-4-6-20(19)14-21/h3-6,11-12,14,17-18,23H,2,7-10,13,15-16H2,1H3,(H,25,26) |
| InChIKey | YZBFXXRADXRHOK-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |