C29H42BrN3O2S — CID 157076055
2-[4-[(3,5-dimethylphenyl)methyl-naphthalen-2-ylsulfonylamino]butyl-methylamino]ethyl-trimethylazanium bromide (PubChem CID 157076055) has the molecular formula C29H42BrN3O2S and a molecular weight of 576.65 g/mol. Its IUPAC name is 2-[4-[(3,5-dimethylphenyl)methyl-naphthalen-2-ylsulfonylamino]butyl-methylamino]ethyl-trimethylazanium bromide.
| Compound Name | 2-[4-[(3,5-dimethylphenyl)methyl-naphthalen-2-ylsulfonylamino]butyl-methylamino]ethyl-trimethylazanium bromide |
|---|---|
| PubChem CID | 157076055 |
| Molecular Formula | C29H42BrN3O2S |
| Molecular Weight | 576.65 g/mol |
| Exact Mass | 575.22 |
| IUPAC Name | 2-[4-[(3,5-dimethylphenyl)methyl-naphthalen-2-ylsulfonylamino]butyl-methylamino]ethyl-trimethylazanium bromide |
| SMILES | Cc1cc(C)cc(CN(CCCCN(C)CC[N+](C)(C)C)S(=O)(=O)c2ccc3ccccc3c2)c1.[Br-] |
| InChI | InChI=1S/C29H42N3O2S.BrH/c1-24-19-25(2)21-26(20-24)23-31(16-10-9-15-30(3)17-18-32(4,5)6)35(33,34)29-14-13-27-11-7-8-12-28(27)22-29;/h7-8,11-14,19-22H,9-10,15-18,23H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | VYMDGEBKVIVKSN-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.65 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|