C24H31BrN2O2S — CID 160852187
(3,5-dimethylphenyl)methyl-dimethyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]ethyl]azanium bromide (PubChem CID 160852187) has the molecular formula C24H31BrN2O2S and a molecular weight of 491.50 g/mol. Its IUPAC name is (3,5-dimethylphenyl)methyl-dimethyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]ethyl]azanium bromide.
| Compound Name | (3,5-dimethylphenyl)methyl-dimethyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]ethyl]azanium bromide |
|---|---|
| PubChem CID | 160852187 |
| Molecular Formula | C24H31BrN2O2S |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | (3,5-dimethylphenyl)methyl-dimethyl-[2-[methyl(naphthalen-2-ylsulfonyl)amino]ethyl]azanium bromide |
| SMILES | Cc1cc(C)cc(C[N+](C)(C)CCN(C)S(=O)(=O)c2ccc3ccccc3c2)c1.[Br-] |
| InChI | InChI=1S/C24H31N2O2S.BrH/c1-19-14-20(2)16-21(15-19)18-26(4,5)13-12-25(3)29(27,28)24-11-10-22-8-6-7-9-23(22)17-24;/h6-11,14-17H,12-13,18H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | OCESWPQGOKVDEL-UHFFFAOYSA-M |
| XLogP | 1.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|