C20H21NO4S — CID 4885068
N-[(2,4-dimethoxyphenyl)methyl]-N-methylnaphthalene-2-sulfonamide (PubChem CID 4885068) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-N-methylnaphthalene-2-sulfonamide.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-N-methylnaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 4885068 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-N-methylnaphthalene-2-sulfonamide |
| SMILES | COc1ccc(CN(C)S(=O)(=O)c2ccc3ccccc3c2)c(OC)c1 |
| InChI | InChI=1S/C20H21NO4S/c1-21(14-17-8-10-18(24-2)13-20(17)25-3)26(22,23)19-11-9-15-6-4-5-7-16(15)12-19/h4-13H,14H2,1-3H3 |
| InChIKey | UIVYXMQZIFKVJC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |