C19H20N2O2 — CID 175769838
N-[(2,4-dimethoxyphenyl)methyl]-N-methylquinolin-2-amine (PubChem CID 175769838) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methyl]-N-methylquinolin-2-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methyl]-N-methylquinolin-2-amine |
|---|---|
| PubChem CID | 175769838 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methyl]-N-methylquinolin-2-amine |
| SMILES | COc1ccc(CN(C)c2ccc3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-21(13-15-8-10-16(22-2)12-18(15)23-3)19-11-9-14-6-4-5-7-17(14)20-19/h4-12H,13H2,1-3H3 |
| InChIKey | CMGOIHHLDLCOCA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |