C19H17NO3S — CID 7755035
1-(2,4-dimethoxyphenyl)-2-quinolin-2-ylsulfanylethanone (PubChem CID 7755035) has the molecular formula C19H17NO3S and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-quinolin-2-ylsulfanylethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-quinolin-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 7755035 |
| Molecular Formula | C19H17NO3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-quinolin-2-ylsulfanylethanone |
| SMILES | COc1ccc(C(=O)CSc2ccc3ccccc3n2)c(OC)c1 |
| InChI | InChI=1S/C19H17NO3S/c1-22-14-8-9-15(18(11-14)23-2)17(21)12-24-19-10-7-13-5-3-4-6-16(13)20-19/h3-11H,12H2,1-2H3 |
| InChIKey | SAHZEFNCXHYBHI-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |