C36H42ClN2O4S+ — CID 59780734
5-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[4-[1-[(3,5-dimethylphenyl)methyl]pyrrolidin-1-ium-1-yl]butyl]naphthalene-2-sulfonamide (PubChem CID 59780734) has the molecular formula C36H42ClN2O4S+ and a molecular weight of 634.26 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[4-[1-[(3,5-dimethylphenyl)methyl]pyrrolidin-1-ium-1-yl]butyl]naphthalene-2-sulfonamide.
| Compound Name | 5-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[4-[1-[(3,5-dimethylphenyl)methyl]pyrrolidin-1-ium-1-yl]butyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 59780734 |
| Molecular Formula | C36H42ClN2O4S+ |
| Molecular Weight | 634.26 g/mol |
| Exact Mass | 633.25 |
| IUPAC Name | 5-chloro-N-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-N-[4-[1-[(3,5-dimethylphenyl)methyl]pyrrolidin-1-ium-1-yl]butyl]naphthalene-2-sulfonamide |
| SMILES | Cc1cc(C)cc(C[N+]2(CCCCN(Cc3ccc4c(c3)OCCO4)S(=O)(=O)c3ccc4c(Cl)cccc4c3)CCCC2)c1 |
| InChI | InChI=1S/C36H42ClN2O4S/c1-27-20-28(2)22-30(21-27)26-39(16-5-6-17-39)15-4-3-14-38(25-29-10-13-35-36(23-29)43-19-18-42-35)44(40,41)32-11-12-33-31(24-32)8-7-9-34(33)37/h7-13,20-24H,3-6,14-19,25-26H2,1-2H3/q+1 |
| InChIKey | BRYMGHBRTDVCMM-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.26 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|