C26H31ClN2O4S — CID 71068261
N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-N-[4-(diethylamino)butyl]naphthalene-2-sulfonamide (PubChem CID 71068261) has the molecular formula C26H31ClN2O4S and a molecular weight of 503.06 g/mol. Its IUPAC name is N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-N-[4-(diethylamino)butyl]naphthalene-2-sulfonamide.
| Compound Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-N-[4-(diethylamino)butyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 71068261 |
| Molecular Formula | C26H31ClN2O4S |
| Molecular Weight | 503.06 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | N-[(6-chloro-1,3-benzodioxol-5-yl)methyl]-N-[4-(diethylamino)butyl]naphthalene-2-sulfonamide |
| SMILES | CCN(CC)CCCCN(Cc1cc2c(cc1Cl)OCO2)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C26H31ClN2O4S/c1-3-28(4-2)13-7-8-14-29(18-22-16-25-26(17-24(22)27)33-19-32-25)34(30,31)23-12-11-20-9-5-6-10-21(20)15-23/h5-6,9-12,15-17H,3-4,7-8,13-14,18-19H2,1-2H3 |
| InChIKey | QEZDGCAFFKWMNV-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.06 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|