C21H18ClF3N2O3S — CID 45375647
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[ethyl(naphthalen-2-ylsulfonyl)amino]acetamide (PubChem CID 45375647) has the molecular formula C21H18ClF3N2O3S and a molecular weight of 470.90 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[ethyl(naphthalen-2-ylsulfonyl)amino]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[ethyl(naphthalen-2-ylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 45375647 |
| Molecular Formula | C21H18ClF3N2O3S |
| Molecular Weight | 470.90 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[ethyl(naphthalen-2-ylsulfonyl)amino]acetamide |
| SMILES | CCN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H18ClF3N2O3S/c1-2-27(31(29,30)17-9-7-14-5-3-4-6-15(14)11-17)13-20(28)26-16-8-10-19(22)18(12-16)21(23,24)25/h3-12H,2,13H2,1H3,(H,26,28) |
| InChIKey | DJBVEQYBNDWTQX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.90 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |