C19H14ClF3N2O5S — CID 24678197
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-(2-oxochromen-6-yl)sulfonylamino]acetamide (PubChem CID 24678197) has the molecular formula C19H14ClF3N2O5S and a molecular weight of 474.84 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-(2-oxochromen-6-yl)sulfonylamino]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-(2-oxochromen-6-yl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 24678197 |
| Molecular Formula | C19H14ClF3N2O5S |
| Molecular Weight | 474.84 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-(2-oxochromen-6-yl)sulfonylamino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)S(=O)(=O)c1ccc2oc(=O)ccc2c1 |
| InChI | InChI=1S/C19H14ClF3N2O5S/c1-25(10-17(26)24-12-3-5-15(20)14(9-12)19(21,22)23)31(28,29)13-4-6-16-11(8-13)2-7-18(27)30-16/h2-9H,10H2,1H3,(H,24,26) |
| InChIKey | DARDKVGRBRZWRE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.84 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|