C14H14ClF3N2O3 — CID 26293555
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-[(3S)-2-oxooxolan-3-yl]amino]acetamide (PubChem CID 26293555) has the molecular formula C14H14ClF3N2O3 and a molecular weight of 350.72 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-[(3S)-2-oxooxolan-3-yl]amino]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-[(3S)-2-oxooxolan-3-yl]amino]acetamide |
|---|---|
| PubChem CID | 26293555 |
| Molecular Formula | C14H14ClF3N2O3 |
| Molecular Weight | 350.72 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[methyl-[(3S)-2-oxooxolan-3-yl]amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)[C@H]1CCOC1=O |
| InChI | InChI=1S/C14H14ClF3N2O3/c1-20(11-4-5-23-13(11)22)7-12(21)19-8-2-3-10(15)9(6-8)14(16,17)18/h2-3,6,11H,4-5,7H2,1H3,(H,19,21)/t11-/m0/s1 |
| InChIKey | ZLFZUFHTMADCDO-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.72 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |