C17H19ClF3N3O3 — CID 46689409
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(2-oxooxolan-3-yl)piperazin-1-yl]acetamide (PubChem CID 46689409) has the molecular formula C17H19ClF3N3O3 and a molecular weight of 405.80 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(2-oxooxolan-3-yl)piperazin-1-yl]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(2-oxooxolan-3-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46689409 |
| Molecular Formula | C17H19ClF3N3O3 |
| Molecular Weight | 405.80 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[4-(2-oxooxolan-3-yl)piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(C2CCOC2=O)CC1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H19ClF3N3O3/c18-13-2-1-11(9-12(13)17(19,20)21)22-15(25)10-23-4-6-24(7-5-23)14-3-8-27-16(14)26/h1-2,9,14H,3-8,10H2,(H,22,25) |
| InChIKey | VHBBRMIQEQWLBL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.80 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |