C16H18ClF3N2O — CID 56513242
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[cyclohex-2-en-1-yl(methyl)amino]acetamide (PubChem CID 56513242) has the molecular formula C16H18ClF3N2O and a molecular weight of 346.78 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[cyclohex-2-en-1-yl(methyl)amino]acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[cyclohex-2-en-1-yl(methyl)amino]acetamide |
|---|---|
| PubChem CID | 56513242 |
| Molecular Formula | C16H18ClF3N2O |
| Molecular Weight | 346.78 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-[cyclohex-2-en-1-yl(methyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C1C=CCCC1 |
| InChI | InChI=1S/C16H18ClF3N2O/c1-22(12-5-3-2-4-6-12)10-15(23)21-11-7-8-14(17)13(9-11)16(18,19)20/h3,5,7-9,12H,2,4,6,10H2,1H3,(H,21,23) |
| InChIKey | VXLWJKVLORAEQZ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|