C15H17ClF3N3O3 — CID 119683149
N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide (PubChem CID 119683149) has the molecular formula C15H17ClF3N3O3 and a molecular weight of 379.77 g/mol. Its IUPAC name is N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide.
| Compound Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide |
|---|---|
| PubChem CID | 119683149 |
| Molecular Formula | C15H17ClF3N3O3 |
| Molecular Weight | 379.77 g/mol |
| Exact Mass | 379.09 |
| IUPAC Name | N-[2-[4-chloro-3-(trifluoromethyl)anilino]-2-oxoethyl]-N-methylmorpholine-3-carboxamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)C1COCCN1 |
| InChI | InChI=1S/C15H17ClF3N3O3/c1-22(14(24)12-8-25-5-4-20-12)7-13(23)21-9-2-3-11(16)10(6-9)15(17,18)19/h2-3,6,12,20H,4-5,7-8H2,1H3,(H,21,23) |
| InChIKey | MOEALKONAWEZDM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.77 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |