C20H27NO6S2 — CID 59350260
N-(benzenesulfonyl)-3,4-dihydroxy-N-octylbenzenesulfonamide (PubChem CID 59350260) has the molecular formula C20H27NO6S2 and a molecular weight of 441.57 g/mol. Its IUPAC name is N-(benzenesulfonyl)-3,4-dihydroxy-N-octylbenzenesulfonamide.
| Compound Name | N-(benzenesulfonyl)-3,4-dihydroxy-N-octylbenzenesulfonamide |
|---|---|
| PubChem CID | 59350260 |
| Molecular Formula | C20H27NO6S2 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | N-(benzenesulfonyl)-3,4-dihydroxy-N-octylbenzenesulfonamide |
| SMILES | CCCCCCCCN(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C20H27NO6S2/c1-2-3-4-5-6-10-15-21(28(24,25)17-11-8-7-9-12-17)29(26,27)18-13-14-19(22)20(23)16-18/h7-9,11-14,16,22-23H,2-6,10,15H2,1H3 |
| InChIKey | FEKSAJOCLYYMFL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|