C16H22N2O2S — CID 143170969
2-formyl-N,3-dimethyl-N-pentyl-1H-indole-5-sulfinamide (PubChem CID 143170969) has the molecular formula C16H22N2O2S and a molecular weight of 306.43 g/mol. Its IUPAC name is 2-formyl-N,3-dimethyl-N-pentyl-1H-indole-5-sulfinamide.
| Compound Name | 2-formyl-N,3-dimethyl-N-pentyl-1H-indole-5-sulfinamide |
|---|---|
| PubChem CID | 143170969 |
| Molecular Formula | C16H22N2O2S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-formyl-N,3-dimethyl-N-pentyl-1H-indole-5-sulfinamide |
| SMILES | CCCCCN(C)S(=O)c1ccc2[nH]c(C=O)c(C)c2c1 |
| InChI | InChI=1S/C16H22N2O2S/c1-4-5-6-9-18(3)21(20)13-7-8-15-14(10-13)12(2)16(11-19)17-15/h7-8,10-11,17H,4-6,9H2,1-3H3 |
| InChIKey | VBDSPXJAIWQPST-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|