C21H35N — CID 163588867
2,5-dimethyl-N-(3-methylbut-1-en-2-yl)-N-octylaniline (PubChem CID 163588867) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is 2,5-dimethyl-N-(3-methylbut-1-en-2-yl)-N-octylaniline.
| Compound Name | 2,5-dimethyl-N-(3-methylbut-1-en-2-yl)-N-octylaniline |
|---|---|
| PubChem CID | 163588867 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | 2,5-dimethyl-N-(3-methylbut-1-en-2-yl)-N-octylaniline |
| SMILES | C=C(C(C)C)N(CCCCCCCC)c1cc(C)ccc1C |
| InChI | InChI=1S/C21H35N/c1-7-8-9-10-11-12-15-22(20(6)17(2)3)21-16-18(4)13-14-19(21)5/h13-14,16-17H,6-12,15H2,1-5H3 |
| InChIKey | GNVDGTJBRRGWQW-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|