C17H20N2O2S — CID 113057769
N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]thiophene-2-carboxamide (PubChem CID 113057769) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113057769 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]thiophene-2-carboxamide |
| SMILES | CC(=O)N(CCNC(=O)c1cccs1)c1cc(C)ccc1C |
| InChI | InChI=1S/C17H20N2O2S/c1-12-6-7-13(2)15(11-12)19(14(3)20)9-8-18-17(21)16-5-4-10-22-16/h4-7,10-11H,8-9H2,1-3H3,(H,18,21) |
| InChIKey | JRBWWAPTRMQDMK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |