C15H14Cl2N2O2S — CID 113063780
N-[2-(N-acetyl-2,6-dichloroanilino)ethyl]thiophene-2-carboxamide (PubChem CID 113063780) has the molecular formula C15H14Cl2N2O2S and a molecular weight of 357.26 g/mol. Its IUPAC name is N-[2-(N-acetyl-2,6-dichloroanilino)ethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-(N-acetyl-2,6-dichloroanilino)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 113063780 |
| Molecular Formula | C15H14Cl2N2O2S |
| Molecular Weight | 357.26 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | N-[2-(N-acetyl-2,6-dichloroanilino)ethyl]thiophene-2-carboxamide |
| SMILES | CC(=O)N(CCNC(=O)c1cccs1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H14Cl2N2O2S/c1-10(20)19(14-11(16)4-2-5-12(14)17)8-7-18-15(21)13-6-3-9-22-13/h2-6,9H,7-8H2,1H3,(H,18,21) |
| InChIKey | GABOVPKSIVRMCU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.26 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |