C19H19F3N2O2 — CID 113057810
N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]-2,3,4-trifluorobenzamide (PubChem CID 113057810) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]-2,3,4-trifluorobenzamide.
| Compound Name | N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]-2,3,4-trifluorobenzamide |
|---|---|
| PubChem CID | 113057810 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-[2-(N-acetyl-2,5-dimethylanilino)ethyl]-2,3,4-trifluorobenzamide |
| SMILES | CC(=O)N(CCNC(=O)c1ccc(F)c(F)c1F)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H19F3N2O2/c1-11-4-5-12(2)16(10-11)24(13(3)25)9-8-23-19(26)14-6-7-15(20)18(22)17(14)21/h4-7,10H,8-9H2,1-3H3,(H,23,26) |
| InChIKey | ARHSASHTRPBFJS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|