C30H59N3O10+2 — CID 140580932
tris(2-hydroxyethyl)-[2-[2-[2-methoxy-5-methyl-N-[2-[2-[2-[tris(2-hydroxyethyl)azaniumyl]ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl]azanium (PubChem CID 140580932) has the molecular formula C30H59N3O10+2 and a molecular weight of 621.81 g/mol. Its IUPAC name is tris(2-hydroxyethyl)-[2-[2-[2-methoxy-5-methyl-N-[2-[2-[2-[tris(2-hydroxyethyl)azaniumyl]ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl]azanium.
| Compound Name | tris(2-hydroxyethyl)-[2-[2-[2-methoxy-5-methyl-N-[2-[2-[2-[tris(2-hydroxyethyl)azaniumyl]ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 140580932 |
| Molecular Formula | C30H59N3O10+2 |
| Molecular Weight | 621.81 g/mol |
| Exact Mass | 621.42 |
| IUPAC Name | tris(2-hydroxyethyl)-[2-[2-[2-methoxy-5-methyl-N-[2-[2-[2-[tris(2-hydroxyethyl)azaniumyl]ethoxy]ethoxy]ethyl]anilino]ethoxy]ethyl]azanium |
| SMILES | COc1ccc(C)cc1N(CCOCCOCC[N+](CCO)(CCO)CCO)CCOCC[N+](CCO)(CCO)CCO |
| InChI | InChI=1S/C30H59N3O10/c1-28-3-4-30(40-2)29(27-28)31(5-21-41-23-13-32(7-15-34,8-16-35)9-17-36)6-22-42-25-26-43-24-14-33(10-18-37,11-19-38)12-20-39/h3-4,27,34-39H,5-26H2,1-2H3/q+2 |
| InChIKey | CWQAHMTYOSNIFI-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 161.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.81 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|