C24H38N2O6 — CID 161365967
2-[2-[N-[2-(2-hydroxyethoxy)ethyl]-2-methoxy-5-methylanilino]ethoxy]ethanol;2-methoxy-5-methylaniline (PubChem CID 161365967) has the molecular formula C24H38N2O6 and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[2-[N-[2-(2-hydroxyethoxy)ethyl]-2-methoxy-5-methylanilino]ethoxy]ethanol;2-methoxy-5-methylaniline.
| Compound Name | 2-[2-[N-[2-(2-hydroxyethoxy)ethyl]-2-methoxy-5-methylanilino]ethoxy]ethanol;2-methoxy-5-methylaniline |
|---|---|
| PubChem CID | 161365967 |
| Molecular Formula | C24H38N2O6 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 2-[2-[N-[2-(2-hydroxyethoxy)ethyl]-2-methoxy-5-methylanilino]ethoxy]ethanol;2-methoxy-5-methylaniline |
| SMILES | COc1ccc(C)cc1N.COc1ccc(C)cc1N(CCOCCO)CCOCCO |
| InChI | InChI=1S/C16H27NO5.C8H11NO/c1-14-3-4-16(20-2)15(13-14)17(5-9-21-11-7-18)6-10-22-12-8-19;1-6-3-4-8(10-2)7(9)5-6/h3-4,13,18-19H,5-12H2,1-2H3;3-5H,9H2,1-2H3 |
| InChIKey | VPUTWNAZGOPHFR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|