C30H50N2O2+2 — CID 59960006
triethyl-[2-[2-methyl-5-(4-methylphenyl)-4-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl]azanium (PubChem CID 59960006) has the molecular formula C30H50N2O2+2 and a molecular weight of 470.74 g/mol. Its IUPAC name is triethyl-[2-[2-methyl-5-(4-methylphenyl)-4-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl]azanium.
| Compound Name | triethyl-[2-[2-methyl-5-(4-methylphenyl)-4-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl]azanium |
|---|---|
| PubChem CID | 59960006 |
| Molecular Formula | C30H50N2O2+2 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.39 |
| IUPAC Name | triethyl-[2-[2-methyl-5-(4-methylphenyl)-4-[2-(triethylazaniumyl)ethoxy]phenoxy]ethyl]azanium |
| SMILES | CC[N+](CC)(CC)CCOc1cc(-c2ccc(C)cc2)c(OCC[N+](CC)(CC)CC)cc1C |
| InChI | InChI=1S/C30H50N2O2/c1-9-31(10-2,11-3)19-21-33-29-24-28(27-17-15-25(7)16-18-27)30(23-26(29)8)34-22-20-32(12-4,13-5)14-6/h15-18,23-24H,9-14,19-22H2,1-8H3/q+2 |
| InChIKey | OKSHLWJDJACGEZ-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|