C26H33N3 — CID 158779403
acetonitrile;N-benzyl-N-ethyl-3-methylaniline;N,3-dimethylaniline (PubChem CID 158779403) has the molecular formula C26H33N3 and a molecular weight of 387.57 g/mol. Its IUPAC name is acetonitrile;N-benzyl-N-ethyl-3-methylaniline;N,3-dimethylaniline.
| Compound Name | acetonitrile;N-benzyl-N-ethyl-3-methylaniline;N,3-dimethylaniline |
|---|---|
| PubChem CID | 158779403 |
| Molecular Formula | C26H33N3 |
| Molecular Weight | 387.57 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | acetonitrile;N-benzyl-N-ethyl-3-methylaniline;N,3-dimethylaniline |
| SMILES | CC#N.CCN(Cc1ccccc1)c1cccc(C)c1.CNc1cccc(C)c1 |
| InChI | InChI=1S/C16H19N.C8H11N.C2H3N/c1-3-17(13-15-9-5-4-6-10-15)16-11-7-8-14(2)12-16;1-7-4-3-5-8(6-7)9-2;1-2-3/h4-12H,3,13H2,1-2H3;3-6,9H,1-2H3;1H3 |
| InChIKey | IQWLTERRFILGCB-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.57 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |