C27H29N3O7S2 — CID 90470566
4-[[4,4-bis(azaniumylmethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-3-hydroxynaphthalene-2,7-disulfonate (PubChem CID 90470566) has the molecular formula C27H29N3O7S2 and a molecular weight of 571.68 g/mol. Its IUPAC name is 4-[[4,4-bis(azaniumylmethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-3-hydroxynaphthalene-2,7-disulfonate.
| Compound Name | 4-[[4,4-bis(azaniumylmethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-3-hydroxynaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 90470566 |
| Molecular Formula | C27H29N3O7S2 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 4-[[4,4-bis(azaniumylmethyl)cyclohexa-2,5-dien-1-ylidene]-[4-(dimethylamino)phenyl]methyl]-3-hydroxynaphthalene-2,7-disulfonate |
| SMILES | CN(C)c1ccc(C(=C2C=CC(C[NH3+])(C[NH3+])C=C2)c2c(O)c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])ccc23)cc1 |
| InChI | InChI=1S/C27H29N3O7S2/c1-30(2)20-5-3-17(4-6-20)24(18-9-11-27(15-28,16-29)12-10-18)25-22-8-7-21(38(32,33)34)13-19(22)14-23(26(25)31)39(35,36)37/h3-14,31H,15-16,28-29H2,1-2H3,(H,32,33,34)(H,35,36,37) |
| InChIKey | NFDKXGUDUHRFMD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 193.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|