C27H26N2NaO7S2 — CID 131852304
CID 131852304 (PubChem CID 131852304) has the molecular formula C27H26N2NaO7S2 and a molecular weight of 577.64 g/mol.
| Compound Name | CID 131852304 |
|---|---|
| PubChem CID | 131852304 |
| Molecular Formula | C27H26N2NaO7S2 |
| Molecular Weight | 577.64 g/mol |
| Exact Mass | 577.11 |
| IUPAC Name | — |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2c(O)c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)O)ccc23)cc1.[Na] |
| InChI | InChI=1S/C27H26N2O7S2.Na/c1-28(2)20-9-5-17(6-10-20)25(18-7-11-21(12-8-18)29(3)4)26-23-14-13-22(37(31,32)33)15-19(23)16-24(27(26)30)38(34,35)36;/h5-16H,1-4H3,(H2,31,32,33,34,35,36); |
| InChIKey | WCPVWGORDJAZNB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 138.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.64 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|