C37H38N3O6S2+ — CID 131701233
[4-[[4-(dimethylamino)phenyl]-[4-[[phenyl(sulfo)methyl]-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 131701233) has the molecular formula C37H38N3O6S2+ and a molecular weight of 684.86 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-[4-[[phenyl(sulfo)methyl]-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-[4-[[phenyl(sulfo)methyl]-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 131701233 |
| Molecular Formula | C37H38N3O6S2+ |
| Molecular Weight | 684.86 g/mol |
| Exact Mass | 684.22 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-[4-[[phenyl(sulfo)methyl]-[(3-sulfophenyl)methyl]amino]phenyl]methylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccc(N(Cc3cccc(S(=O)(=O)O)c3)C(c3ccccc3)S(=O)(=O)O)cc2)cc1 |
| InChI | InChI=1S/C37H37N3O6S2/c1-38(2)32-19-13-28(14-20-32)36(29-15-21-33(22-16-29)39(3)4)30-17-23-34(24-18-30)40(26-27-9-8-12-35(25-27)47(41,42)43)37(48(44,45)46)31-10-6-5-7-11-31/h5-25,37H,26H2,1-4H3,(H-,41,42,43,44,45,46)/p+1 |
| InChIKey | WSUFFUARAHBFOC-UHFFFAOYSA-O |
| XLogP | 6.23 |
| TPSA | 118.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.86 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|