C17H11BaClN2O10S3 — CID 135853581
barium(2+);4-[(5-chloro-4-methyl-2-sulfophenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate (PubChem CID 135853581) has the molecular formula C17H11BaClN2O10S3 and a molecular weight of 672.26 g/mol. Its IUPAC name is barium(2+);4-[(5-chloro-4-methyl-2-sulfophenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate.
| Compound Name | barium(2+);4-[(5-chloro-4-methyl-2-sulfophenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate |
|---|---|
| PubChem CID | 135853581 |
| Molecular Formula | C17H11BaClN2O10S3 |
| Molecular Weight | 672.26 g/mol |
| Exact Mass | 671.83 |
| IUPAC Name | barium(2+);4-[(5-chloro-4-methyl-2-sulfophenyl)diazenyl]-3-hydroxynaphthalene-2,7-disulfonate |
| SMILES | Cc1cc(S(=O)(=O)O)c(/N=N/c2c(O)c(S(=O)(=O)[O-])cc3cc(S(=O)(=O)[O-])ccc23)cc1Cl.[Ba+2] |
| InChI | InChI=1S/C17H13ClN2O10S3.Ba/c1-8-4-14(32(25,26)27)13(7-12(8)18)19-20-16-11-3-2-10(31(22,23)24)5-9(11)6-15(17(16)21)33(28,29)30;/h2-7,21H,1H3,(H,22,23,24)(H,25,26,27)(H,28,29,30);/q;+2/p-2/b20-19+; |
| InChIKey | WWLROPLRXSQGBH-RZLHGTIFSA-L |
| XLogP | 2.60 |
| TPSA | 213.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.26 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|