C23H28N2O8PW — CID 6454250
[4-[[4-(dimethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;hydroxy(dioxo)tungsten;hydroxy hydrogen phosphate (PubChem CID 6454250) has the molecular formula C23H28N2O8PW and a molecular weight of 675.30 g/mol. Its IUPAC name is [4-[[4-(dimethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;hydroxy(dioxo)tungsten;hydroxy hydrogen phosphate.
| Compound Name | [4-[[4-(dimethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;hydroxy(dioxo)tungsten;hydroxy hydrogen phosphate |
|---|---|
| PubChem CID | 6454250 |
| Molecular Formula | C23H28N2O8PW |
| Molecular Weight | 675.30 g/mol |
| Exact Mass | 675.11 |
| IUPAC Name | [4-[[4-(dimethylamino)phenyl]-phenylmethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;hydroxy(dioxo)tungsten;hydroxy hydrogen phosphate |
| SMILES | CN(C)c1ccc(C(=C2C=CC(=[N+](C)C)C=C2)c2ccccc2)cc1.O=P([O-])(O)OO.O=[W](=O)O |
| InChI | InChI=1S/C23H25N2.H3O5P.H2O.2O.W/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4;1-5-6(2,3)4;;;;/h5-17H,1-4H3;1H,(H2,2,3,4);1H2;;;/q+1;;;;;+1/p-2 |
| InChIKey | VIUVDLPEWDNAIP-UHFFFAOYSA-L |
| XLogP | 2.53 |
| TPSA | 150.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|